Products 3179-11-1

CAS 3179-11-1 is the registry number for 1-(4-Carboxyphenyl)-2-nitroethene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.

Structural formula: {0} (CAS {1})

4-(2-nitroethenyl)benzoic acid (CAS 3179-11-1) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 4-(2-nitroethenyl)benzoic acid. InChIKey: GFQGFOJCOPZGPB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO4
Molecular weight193.16 g/mol
IUPAC name4-(2-nitroethenyl)benzoic acid
InChIKeyGFQGFOJCOPZGPB-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C=C[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)