CAS 28691-48-7 is the registry number for 6-Methoxybenzo[d]isoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
6-methoxy-1,2-benzoxazole-3-carboxylic acid (CAS 28691-48-7) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 6-methoxy-1,2-benzoxazole-3-carboxylic acid. InChIKey: CFAGLVIVPXRGPT-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 6-methoxy-1,2-benzoxazole-3-carboxylic acid |
| InChIKey | CFAGLVIVPXRGPT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=NO2)C(=O)O |
Computed by PubChem (NCBI)