CAS 128076-63-1 appears in our catalog under these names: 7-Methoxy-1h-benzo[d][1,3] oxazine-2,4-dione, 98%, 7-Methoxy-1h-benzo(d)(1,3) oxazine-2,4-dione, 7-Methoxy-1H-benzo(d)(1,3)oxazine-2,4-dione, 98%, 7-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 98%, 98%, 7-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 98%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 100mg, 250mg.
7-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 128076-63-1) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 7-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: XAJRDVIVFVGXNN-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 7-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | XAJRDVIVFVGXNN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)