CAS 100246-04-6 is the registry number for Methyl 2-oxo-3H-1,3-benzoxazole-4-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Methyl 2-oxo-3H-1,3-benzoxazole-4-carboxylate (CAS 100246-04-6) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: methyl 2-oxo-3H-1,3-benzoxazole-4-carboxylate. InChIKey: KSQNEWWVQONQCY-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | methyl 2-oxo-3H-1,3-benzoxazole-4-carboxylate |
| InChIKey | KSQNEWWVQONQCY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C1)OC(=O)N2 |
Computed by PubChem (NCBI)