CAS 619-89-6 appears in our catalog under these names: 4-Nitrocinnamic acid, 98%, 4-Nitrocinnamic Acid, 4–Nitrocinnamic acid, predominantly trans, 4-Nitrocinnamic Acid, >99.0%(T), 3-(4-Nitrophenyl)acrylic acid, 98% (E), 98% (E). Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 50g, 10g, 25 g.
(E)-3-(4-nitrophenyl)prop-2-enoic acid (CAS 619-89-6) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: (E)-3-(4-nitrophenyl)prop-2-enoic acid. InChIKey: XMMRNCHTDONGRJ-ZZXKWVIFSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | (E)-3-(4-nitrophenyl)prop-2-enoic acid |
| InChIKey | XMMRNCHTDONGRJ-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)