Products 37715-77-8
CAS 37715-77-8 is the registry number for 3-Phenyl-5h-1,4,2-dioxazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
3-phenyl-1,4,2-dioxazole-5-carboxylic acid (CAS 37715-77-8) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 3-phenyl-1,4,2-dioxazole-5-carboxylic acid. InChIKey: PWOPVELVXHDBAI-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 3-phenyl-1,4,2-dioxazole-5-carboxylic acid |
| InChIKey | PWOPVELVXHDBAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(O2)C(=O)O |
Computed by PubChem (NCBI)