cas: 771510-32-8 — see every product listed under this CAS number, including other names
5,7-Dichloro-3-isopropylpyrazolo[1,5-a]pyrimidine, 97% (CAS 771510-32-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F790497-100MG |
| cas | 771510-32-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1528.65 Pln | |
| Fluorochem | 10g | 2632.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5,7-dichloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidine (CAS 771510-32-8) is a chemical compound with the molecular formula C9H9Cl2N3 and a molecular weight of 230.09 g/mol. IUPAC name: 5,7-dichloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidine. InChIKey: VAAJGCDAYQIYPO-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3 |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 5,7-dichloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidine |
| InChIKey | VAAJGCDAYQIYPO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2N=C(C=C(N2N=C1)Cl)Cl |
Computed by PubChem (NCBI)