cas: 771510-32-8 — see every product listed under this CAS number, including other names
5,7-Dichloro-3-isopropylpyrazolo[1,5-a]pyrimidine, 98%, 98% (CAS 771510-32-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119NW1-250mg |
| cas | 771510-32-8 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 25g | 3371.60 Pln | |
| Chemat | 50g | 5574.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,7-dichloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidine (CAS 771510-32-8) is a chemical compound with the molecular formula C9H9Cl2N3 and a molecular weight of 230.09 g/mol. IUPAC name: 5,7-dichloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidine. InChIKey: VAAJGCDAYQIYPO-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3 |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 5,7-dichloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidine |
| InChIKey | VAAJGCDAYQIYPO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2N=C(C=C(N2N=C1)Cl)Cl |
Computed by PubChem (NCBI)