cas: 6374-92-1 — see every product listed under this CAS number, including other names
5,7-Dichloroindoline-2,3-Dione, ≥95%, ≥95% (CAS 6374-92-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MAO-50mg |
| cas | 6374-92-1 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 141.20 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 371.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5,7-dichloro-1H-indole-2,3-dione (CAS 6374-92-1) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 5,7-dichloro-1H-indole-2,3-dione. InChIKey: AYGGQJHJRFZDFH-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 5,7-dichloro-1H-indole-2,3-dione |
| InChIKey | AYGGQJHJRFZDFH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)Cl)Cl |
Computed by PubChem (NCBI)