cas: 6374-92-1 — see every product listed under this CAS number, including other names
5,7-Dichloroisatin, 97% (CAS 6374-92-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045004-250MG |
| cas | 6374-92-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 2.5g | 1257.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5,7-dichloro-1H-indole-2,3-dione (CAS 6374-92-1) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 5,7-dichloro-1H-indole-2,3-dione. InChIKey: AYGGQJHJRFZDFH-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 5,7-dichloro-1H-indole-2,3-dione |
| InChIKey | AYGGQJHJRFZDFH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)Cl)Cl |
Computed by PubChem (NCBI)