5,7-Dichloroisatin, 95-<97%
cas: 6374-92-1 — see every product listed under this CAS number, including other names
5,7-Dichloroisatin, 95-<97% (CAS 6374-92-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC769-95-97-10g |
| cas | 6374-92-1 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 3740.44 Pln | |
| Hoffman Fine Chemicals | 25g | 7172.88 Pln | |
| Hoffman Fine Chemicals | 50g | 11294.36 Pln | |
| Hoffman Fine Chemicals | 100g | 17884.90 Pln | |
| Hoffman Fine Chemicals | 200g | 30191.92 Pln | |
| Hoffman Fine Chemicals | 300g | 38409.36 Pln |
properties
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
5,7-dichloro-1H-indole-2,3-dione (CAS 6374-92-1) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 5,7-dichloro-1H-indole-2,3-dione. InChIKey: AYGGQJHJRFZDFH-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 5,7-dichloro-1H-indole-2,3-dione |
| InChIKey | AYGGQJHJRFZDFH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
5,7-Dichloroisatin, 5,7-Dichloro-1H-indole-2,3-dione, 5,7-Dichloroindoline-2,3-dione, 1H-Indole-2,3-dione, 5,7-dichloro-, 5,7-dichloro-2,3-dihydro-1H-indole-2,3-dione, Isatin, 5,7-dichloro-, 5,7-dichloro-1H-benzo[d]azolidine-2,3-dione, Indole-2,3-dione, 5,7-dichloro-, NCIMech_000038, Cambridge id 5228213