cas: 942196-01-2 — see every product listed under this CAS number, including other names
5,8-Difluorochroman-4-one, 97%, 97% (CAS 942196-01-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHZK-100mg |
| cas | 942196-01-2 |
| size | 100mg |
| availability | 18g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 957.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,8-difluoro-2,3-dihydrochromen-4-one (CAS 942196-01-2) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 5,8-difluoro-2,3-dihydrochromen-4-one. InChIKey: MFNOPUXJWQFHSE-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 5,8-difluoro-2,3-dihydrochromen-4-one |
| InChIKey | MFNOPUXJWQFHSE-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2C1=O)F)F |
Computed by PubChem (NCBI)