Products 94977-52-3
CAS 94977-52-3 appears in our catalog under these names: (E)-3-(2,4-Difluorophenyl)acrylic acid 98%, (E)-3-(2,4-Difluorophenyl)acrylic acid, 97%, 97%, 2,4-Difluorocinnamic acid, 98%, trans–2,4–Difluorocinnamic acid, trans-2,4-Difluorocinnamic acid. Offered by: Ambeed, Chemat, Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 50g.
(E)-3-(2,4-difluorophenyl)prop-2-enoic acid (CAS 94977-52-3) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: (E)-3-(2,4-difluorophenyl)prop-2-enoic acid. InChIKey: PQDXPFJQTKGTFP-DUXPYHPUSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | (E)-3-(2,4-difluorophenyl)prop-2-enoic acid |
| InChIKey | PQDXPFJQTKGTFP-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Difluorocinnamic acid, (E)-3-(2,4-difluorophenyl)acrylic acid, trans-2,4-Difluorocinnamic acid, (E)-3-(2,4-difluorophenyl)prop-2-enoic acid, 3-(2,4-difluorophenyl)prop-2-enoic acid, (2E)-3-(2,4-difluorophenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(2,4-difluorophenyl)-, (2E)-, 2,4-Difluorocinnamicacid, (E)-2,4-difluorocinnamic acid, trans-2,4-Difluorocinnamic acid, 97%