Products 890840-90-1
CAS 890840-90-1 appears in our catalog under these names: 7,8-Difluorochroman-4-one, 95%, 7，8–Difluorochroman–4–one, 7,8-Difluorochroman-4-one 97%, 7,8-Difluorochroman-4-one, 97%, 97%, 7,8-Difluorochroman-4-one, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 500mg, 25g.
7,8-difluoro-2,3-dihydrochromen-4-one (CAS 890840-90-1) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 7,8-difluoro-2,3-dihydrochromen-4-one. InChIKey: QVMSLYKXQLIIRA-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 7,8-difluoro-2,3-dihydrochromen-4-one |
| InChIKey | QVMSLYKXQLIIRA-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=C2F)F |
Computed by PubChem (NCBI)