CAS 1645954-81-9 is the registry number for 2,2-Difluoro-5-vinyl-benzo[1,3]dioxole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-ethenyl-2,2-difluoro-1,3-benzodioxole (CAS 1645954-81-9) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 5-ethenyl-2,2-difluoro-1,3-benzodioxole. InChIKey: HLEGAWUPWVKBTL-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 5-ethenyl-2,2-difluoro-1,3-benzodioxole |
| InChIKey | HLEGAWUPWVKBTL-UHFFFAOYSA-N |
| SMILES | C=CC1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)