Products 942196-01-2
CAS 942196-01-2 appears in our catalog under these names: 5,8-Difluorochroman-4-one, 95%, 5，8–Difluorochroman–4–one, 5,8-Difluorochroman-4-one, 5,8-Difluorochroman-4-one, 97%, 97%, 5,8-Difluorochroman-4-one, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 2,5g.
5,8-difluoro-2,3-dihydrochromen-4-one (CAS 942196-01-2) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 5,8-difluoro-2,3-dihydrochromen-4-one. InChIKey: MFNOPUXJWQFHSE-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 5,8-difluoro-2,3-dihydrochromen-4-one |
| InChIKey | MFNOPUXJWQFHSE-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2C1=O)F)F |
Computed by PubChem (NCBI)