CAS 2383261-53-6 is the registry number for 3-Acetyl-2,6-difluorobenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-acetyl-2,6-difluorobenzaldehyde (CAS 2383261-53-6) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 3-acetyl-2,6-difluorobenzaldehyde. InChIKey: VHQPBGBICXURDH-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 3-acetyl-2,6-difluorobenzaldehyde |
| InChIKey | VHQPBGBICXURDH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)F)C=O)F |
Computed by PubChem (NCBI)