Products 1092349-93-3
CAS 1092349-93-3 appears in our catalog under these names: 6,7-Difluorochroman-4-one, 95%, 6,7-Difluorochroman-4-one, 98%, 98%, 6,7-Difluorochroman-4-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
6,7-difluoro-2,3-dihydrochromen-4-one (CAS 1092349-93-3) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 6,7-difluoro-2,3-dihydrochromen-4-one. InChIKey: WGCSANGNQYZBTQ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 6,7-difluoro-2,3-dihydrochromen-4-one |
| InChIKey | WGCSANGNQYZBTQ-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2C1=O)F)F |
Computed by PubChem (NCBI)