cas: 2970966-04-0 — see every product listed under this CAS number, including other names
5-(1,2-Dimethyl-1H-benzo[e]indol-1-yl)pentyl acetate, 95% (CAS 2970966-04-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch13M0LL-100mg |
| cas | 2970966-04-0 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 630.80 Pln | |
| Chemat | 5g | 2210.00 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 555.03 Pln | |
| Fluorochem | 1g | 1054.85 Pln | |
| Fluorochem | 5g | 3215.55 Pln | |
| Fluorochem | 10g | 5298.15 Pln | |
| Fluorochem | 25g | 10327.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(1,2-dimethylbenzo[e]indol-1-yl)pentyl acetate (CAS 2970966-04-0) is a chemical compound with the molecular formula C21H25NO2 and a molecular weight of 323.4 g/mol. IUPAC name: 5-(1,2-dimethylbenzo[e]indol-1-yl)pentyl acetate. InChIKey: PXOQSQQLDKVRMJ-UHFFFAOYSA-N.
| Molecular formula | C21H25NO2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 5-(1,2-dimethylbenzo[e]indol-1-yl)pentyl acetate |
| InChIKey | PXOQSQQLDKVRMJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)CCCCCOC(=O)C)C3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)