CAS 249278-28-2 appears in our catalog under these names: 2',4',6'–Trihydroxyacetophenone monohydrate, 2',4',6'-Trihydroxyacetophenone monohydrate, 2',4',6'-Trihydroxyacetophenone Monohydrate 98%, 2',4',6'-Trihydroxyacetophenone monohydrate, 97%, 2',4',6'-Trihydroxyacetophenone Monohydrate, >95% (HPLC). Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, TRC. Available pack sizes: 100g, 25g, 250g, 500g, 1000g, 5g, 100mg, 10mg.
1-(2,4,6-trihydroxyphenyl)ethanone;hydrate (CAS 249278-28-2) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 1-(2,4,6-trihydroxyphenyl)ethanone;hydrate. InChIKey: GDSIBPPJKSBCMF-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 1-(2,4,6-trihydroxyphenyl)ethanone;hydrate |
| InChIKey | GDSIBPPJKSBCMF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1O)O)O.O |
Computed by PubChem (NCBI)