CAS 15568-85-1 appears in our catalog under these names: 5–(Methoxymethylene)–2,2–dimethyl–1,3–dioxane–4,6–dione, 5-(Methoxymethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione 97% HPLC, 5-(Methoxymethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 97%, 97%, 5-(Methoxymethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g, 1000g, 50g.
5-(methoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 15568-85-1) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 5-(methoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: DVLSQHLXPRYYRC-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 5-(methoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | DVLSQHLXPRYYRC-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=COC)C(=O)O1)C |
Computed by PubChem (NCBI)