cas: 54463-89-7 — see every product listed under this CAS number, including other names
5-(2-Chlorophenyl)-4H-1,2,4-triazol-3-amine, 95+% (CAS 54463-89-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A223551-5g |
| cas | 54463-89-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7178.92 Pln | |
| AmBeed | 100mg | 701.47 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(2-chlorophenyl)-1H-1,2,4-triazol-3-amine (CAS 54463-89-7) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 5-(2-chlorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: LVSNWMVOAUEVKU-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | LVSNWMVOAUEVKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NN2)N)Cl |
Computed by PubChem (NCBI)