cas: 885278-43-3 — see every product listed under this CAS number, including other names
5-(4-chloro-3-methylphenyl)-1H-1,2,3,4-tetrazole, 97% (CAS 885278-43-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F872491-100MG |
| cas | 885278-43-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 883.04 Pln | |
| Fluorochem | 250mg | 1450.55 Pln | |
| Fluorochem | 1g | 3793.47 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-(4-chloro-3-methylphenyl)-2H-tetrazole (CAS 885278-43-3) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 5-(4-chloro-3-methylphenyl)-2H-tetrazole. InChIKey: ZUXHJWVZUVPRFT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-(4-chloro-3-methylphenyl)-2H-tetrazole |
| InChIKey | ZUXHJWVZUVPRFT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NNN=N2)Cl |
Computed by PubChem (NCBI)