cas: 31130-15-1 — see every product listed under this CAS number, including other names
5-(4-methylphenyl)-1,3,4-oxadiazole-2-thiol, 97%, 97% (CAS 31130-15-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C2XS-50mg |
| cas | 31130-15-1 |
| size | 50mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 78.80 Pln | |
| Chemat | 100mg | 78.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4-methylphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 31130-15-1) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 5-(4-methylphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: RCICTPARDQGART-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 5-(4-methylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | RCICTPARDQGART-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)