CAS 14444-96-3 is the registry number for 1-(2-Amino-5-thiocyanato-phenyl)-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
(3-acetyl-4-aminophenyl) thiocyanate (CAS 14444-96-3) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: (3-acetyl-4-aminophenyl) thiocyanate. InChIKey: DWWHSRQDHPRWIX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | (3-acetyl-4-aminophenyl) thiocyanate |
| InChIKey | DWWHSRQDHPRWIX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)SC#N)N |
Computed by PubChem (NCBI)