CAS 98879-58-4 appears in our catalog under these names: 2-Amino-5-phenylthiazol-4-ol, 97%, 2-Amino-5-phenyl-1,3-thiazol-4-ol, 97%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 25g, 5g, 10g, 1g.
2-amino-5-phenyl-1,3-thiazol-4-ol (CAS 98879-58-4) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 2-amino-5-phenyl-1,3-thiazol-4-ol. InChIKey: NLOMNHLWRPCJGO-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 2-amino-5-phenyl-1,3-thiazol-4-ol |
| InChIKey | NLOMNHLWRPCJGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(S2)N)O |
Computed by PubChem (NCBI)