CAS 423768-62-1 appears in our catalog under these names: (4-Phenyl-1,2,3-thiadiazol-5-yl)methanol, 95%, (4–Phenyl–1,2,3–thiadiazol–5–yl)methanol, (4-Phenyl-1,2,3-thiadiazol-5-yl)methanol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(4-phenylthiadiazol-5-yl)methanol (CAS 423768-62-1) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: (4-phenylthiadiazol-5-yl)methanol. InChIKey: CCCGCSZUTJHLFD-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | (4-phenylthiadiazol-5-yl)methanol |
| InChIKey | CCCGCSZUTJHLFD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SN=N2)CO |
Computed by PubChem (NCBI)