CAS 17823-27-7 appears in our catalog under these names: 2-Phenylamino-thiazol-4-one, 95%, 2-Phenyliminothiazolidin-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 5000mg.
2-phenylimino-1,3-thiazolidin-4-one (CAS 17823-27-7) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 2-phenylimino-1,3-thiazolidin-4-one. InChIKey: IYGBTPGRKGQPLW-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 2-phenylimino-1,3-thiazolidin-4-one |
| InChIKey | IYGBTPGRKGQPLW-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=NC2=CC=CC=C2)S1 |
Computed by PubChem (NCBI)