CAS 31130-15-1 appears in our catalog under these names: 5-(4-methylphenyl)-1,3,4-oxadiazole-2-thiol, 97%, 5-(4-methylphenyl)-1,3,4-oxadiazole-2-thiol, 97%, 97%, 5-(4-Methylphenyl)-1,3,4-oxadiazole-2-thiol, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 50mg, 100mg.
5-(4-methylphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 31130-15-1) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 5-(4-methylphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: RCICTPARDQGART-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 5-(4-methylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | RCICTPARDQGART-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)