cas: 31130-15-1 — see every product listed under this CAS number, including other names
5-(4-Methylphenyl)-1,3,4-oxadiazole-2-thiol, 95% (CAS 31130-15-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 50mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F012176-100MG |
| cas | 31130-15-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 50mg | 102.07 Pln | |
| Fluorochem | 250mg | 133.30 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-(4-methylphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 31130-15-1) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 5-(4-methylphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: RCICTPARDQGART-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 5-(4-methylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | RCICTPARDQGART-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)