5-(Benzyloxy)isophthalic acid, 95%
cas: 114274-39-4 — see every product listed under this CAS number, including other names
5-(Benzyloxy)isophthalic acid, 95% (CAS 114274-39-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A486217-100mg |
| cas | 114274-39-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 948.88 Pln | |
| Ambeed | 1g | 2439.62 Pln | |
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 808.40 Pln | |
| Chemat | 1g | 2070.80 Pln | |
| BLDpharm | 100mg | 580.93 Pln | |
| BLDpharm | 250mg | 925.25 Pln | |
| BLDpharm | 1g | 2391.40 Pln | |
| Fluorochem | 1g | 3824.71 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-phenylmethoxybenzene-1,3-dicarboxylic acid (CAS 114274-39-4) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: 5-phenylmethoxybenzene-1,3-dicarboxylic acid. InChIKey: IUVPKFJCXNRPIJ-UHFFFAOYSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 5-phenylmethoxybenzene-1,3-dicarboxylic acid |
| InChIKey | IUVPKFJCXNRPIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)