cas: 51802-78-9 — see every product listed under this CAS number, including other names
5-(Chloromethyl)-3-(3-chlorophenyl)-1,2,4-oxadiazole, 97% (CAS 51802-78-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A431206-1g |
| cas | 51802-78-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 545.23 Pln | |
| AmBeed | 25g | 4893.91 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(chloromethyl)-3-(3-chlorophenyl)-1,2,4-oxadiazole (CAS 51802-78-9) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 5-(chloromethyl)-3-(3-chlorophenyl)-1,2,4-oxadiazole. InChIKey: TWFGGYWZWDPXGT-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(3-chlorophenyl)-1,2,4-oxadiazole |
| InChIKey | TWFGGYWZWDPXGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)