CAS 162469-87-6 appears in our catalog under these names: 7-Chloro-2-(chloromethyl)-4h-pyrido[1,2-a]pyrimidin-4-one, 97%, 7-Chloro-2-(chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one, 98%, 98%, 7-chloro-2-(chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g, 10g.
7-chloro-2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one (CAS 162469-87-6) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 7-chloro-2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one. InChIKey: VQYIAJIVEVIZOA-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 7-chloro-2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | VQYIAJIVEVIZOA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1Cl)CCl |
Computed by PubChem (NCBI)