CAS 50737-32-1 appears in our catalog under these names: 5-(Chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole, 98%, 5-Chloromethyl-3-(2-chloro-phenyl)-(1,2,4)oxadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g.
5-(chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole (CAS 50737-32-1) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 5-(chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole. InChIKey: PUZWQESMXKKSGC-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole |
| InChIKey | PUZWQESMXKKSGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CCl)Cl |
Computed by PubChem (NCBI)