CAS 24068-15-3 is the registry number for 2-(Chloromethyl)-5-(4-chlorophenyl)-1,3,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(chloromethyl)-5-(4-chlorophenyl)-1,3,4-oxadiazole (CAS 24068-15-3) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2-(chloromethyl)-5-(4-chlorophenyl)-1,3,4-oxadiazole. InChIKey: AJKIAERFLWQLAM-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(4-chlorophenyl)-1,3,4-oxadiazole |
| InChIKey | AJKIAERFLWQLAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)CCl)Cl |
Computed by PubChem (NCBI)