CAS 347162-92-9 appears in our catalog under these names: 2,8-Dichloro-7-methoxyquinoxaline, 95%, 2,8-Dichloro-7-methoxyquinoxaline, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,8-dichloro-7-methoxyquinoxaline (CAS 347162-92-9) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2,8-dichloro-7-methoxyquinoxaline. InChIKey: MAYRPLDCTXPBCL-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2,8-dichloro-7-methoxyquinoxaline |
| InChIKey | MAYRPLDCTXPBCL-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=NC(=CN=C2C=C1)Cl)Cl |
Computed by PubChem (NCBI)