CAS 953040-09-0 is the registry number for 2,5-Dichloro-8-methoxyquinazoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,5-dichloro-8-methoxyquinazoline (CAS 953040-09-0) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2,5-dichloro-8-methoxyquinazoline. InChIKey: GPTRWYGTLGLSTJ-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2,5-dichloro-8-methoxyquinazoline |
| InChIKey | GPTRWYGTLGLSTJ-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Cl)C=NC(=N2)Cl |
Computed by PubChem (NCBI)