CAS 110704-33-1 appears in our catalog under these names: 3-(Chloromethyl)-5-(2-chlorophenyl)-1,2,4-oxadiazole, 95%, 3–(chloromethyl)–5–(2–chlorophenyl)–1,2,4–oxadiazole, 3-(Chloromethyl)-5-(2-chlorophenyl)-(1,2,4)oxadiazole. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
3-(chloromethyl)-5-(2-chlorophenyl)-1,2,4-oxadiazole (CAS 110704-33-1) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 3-(chloromethyl)-5-(2-chlorophenyl)-1,2,4-oxadiazole. InChIKey: RYRIXIFYINOGIR-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 3-(chloromethyl)-5-(2-chlorophenyl)-1,2,4-oxadiazole |
| InChIKey | RYRIXIFYINOGIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NO2)CCl)Cl |
Computed by PubChem (NCBI)