cas: 5027-65-6 — see every product listed under this CAS number, including other names
5-(METHOXYCARBONYL)NICOTINIC ACID, 95% (CAS 5027-65-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472525-250MG |
| cas | 5027-65-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 763.29 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-methoxycarbonylpyridine-3-carboxylic acid (CAS 5027-65-6) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 5-methoxycarbonylpyridine-3-carboxylic acid. InChIKey: GUXKBDHITFXEJG-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 5-methoxycarbonylpyridine-3-carboxylic acid |
| InChIKey | GUXKBDHITFXEJG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)