5-(Naphthalen-2-yl)isoxazole-3-carboxylic acid, 95%
cas: 1105193-46-1 — see every product listed under this CAS number, including other names
5-(Naphthalen-2-yl)isoxazole-3-carboxylic acid, 95% (CAS 1105193-46-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1076568-100mg |
| cas | 1105193-46-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 659.62 Pln | |
| Ambeed | 250mg | 1065.69 Pln | |
| Ambeed | 1g | 2879.06 Pln | |
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 774.80 Pln | |
| Chemat | 1g | 1984.40 Pln | |
| BLDpharm | 100mg | 647.57 Pln | |
| BLDpharm | 250mg | 1047.43 Pln | |
| BLDpharm | 1g | 2819.03 Pln | |
| Fluorochem | 100mg | 883.04 Pln | |
| Fluorochem | 250mg | 1434.93 Pln | |
| Fluorochem | 1g | 3668.52 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-naphthalen-2-yl-1,2-oxazole-3-carboxylic acid (CAS 1105193-46-1) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 5-naphthalen-2-yl-1,2-oxazole-3-carboxylic acid. InChIKey: JMNRLAJVDKXUAX-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 5-naphthalen-2-yl-1,2-oxazole-3-carboxylic acid |
| InChIKey | JMNRLAJVDKXUAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC(=NO3)C(=O)O |
Computed by PubChem (NCBI)