CAS 109512-76-7 appears in our catalog under these names: 7-Hydroxy-4-(3-pyridyl)coumarin, 7-Hydroxy-4-(3-pyridyl)coumarin, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.
7-hydroxy-4-pyridin-3-ylchromen-2-one (CAS 109512-76-7) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 7-hydroxy-4-pyridin-3-ylchromen-2-one. InChIKey: NXHVMYDCZZUVML-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 7-hydroxy-4-pyridin-3-ylchromen-2-one |
| InChIKey | NXHVMYDCZZUVML-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=O)OC3=C2C=CC(=C3)O |
Computed by PubChem (NCBI)