Products 20000-56-0
CAS 20000-56-0 appears in our catalog under these names: 3-(1,3-Benzoxazol-2-yl)benzoic acid, 95%, 3-(Benzo(d)oxazol-2-yl)benzoic acid, 97%, 3-(1,3-Benzoxazol-2-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
3-(1,3-benzoxazol-2-yl)benzoic acid (CAS 20000-56-0) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 3-(1,3-benzoxazol-2-yl)benzoic acid. InChIKey: VSIDLODXMSPACX-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 3-(1,3-benzoxazol-2-yl)benzoic acid |
| InChIKey | VSIDLODXMSPACX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)