Products 1218-69-5
CAS 1218-69-5 appears in our catalog under these names: 2-(2-Hydroxyphenyl)-4h-benzo[e][1,3]oxazin-4-one, 98%, Deferasirox EP Impurity B, 2-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one, 2–(2–Hydroxyphenyl)–4H–1，3–benzoxazin–4–one, 2-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one, >98.0%(GC). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 1g, 5g, on request, 100mg, 250mg, 25mg, 0,05kg, 500g.
2-(2-hydroxyphenyl)-1,3-benzoxazin-4-one (CAS 1218-69-5) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 2-(2-hydroxyphenyl)-1,3-benzoxazin-4-one. InChIKey: NSWIROGSZPXREF-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-(2-hydroxyphenyl)-1,3-benzoxazin-4-one |
| InChIKey | NSWIROGSZPXREF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)
Synonyms:
2-(2-hydroxyphenyl)-4H-1,3-benzoxazin-4-one, 4H-1,3-Benzoxazin-4-one, 2-(2-hydroxyphenyl)-, DEFERASIROX IMPURITY B [EP IMPURITY], DEFERASIROX IMPURITY B (EP IMPURITY), 2-(2-Hydroxyphenyl)-4H-benzo[e][1,3]oxazin-4-one, Deferasirox Benzoxazin Impurity, 2-(2-Hydroxyphenyl)benz[e][1,3]oxazin-4-one, Deferasirox Impurity 4, 2-(2-Hydroxyphenyl)-4H-1,3-benzoxazine-4-one, 2-(2-hydroxyphenyl) benz [e] [1, 3] oxazin-4-one