Products 1258637-09-0
CAS 1258637-09-0 appears in our catalog under these names: 3-(3-Cyanophenyl)-5-hydroxybenzoic acid, 96%, 3'-Cyano-5-hydroxy-(1,1'-biphenyl)-3-carboxylic acid, 98%, 3–Cyano–5–hydroxy–(1，1–biphenyl)–3–carboxylic acid, 3'-Cyano-5-hydroxy-[1,1'-biphenyl]-3-carboxylic acid, 95%, 95%, 3'-Cyano-5-hydroxy-[1,1'-biphenyl]-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg.
3-(3-cyanophenyl)-5-hydroxybenzoic acid (CAS 1258637-09-0) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 3-(3-cyanophenyl)-5-hydroxybenzoic acid. InChIKey: QYZVOMJDXIGJQH-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 3-(3-cyanophenyl)-5-hydroxybenzoic acid |
| InChIKey | QYZVOMJDXIGJQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC(=C2)O)C(=O)O)C#N |
Computed by PubChem (NCBI)