Products 39695-71-1
CAS 39695-71-1 is the registry number for 3-Phenyl-benzo[c]isoxazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-phenyl-2,1-benzoxazole-5-carboxylic acid (CAS 39695-71-1) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 3-phenyl-2,1-benzoxazole-5-carboxylic acid. InChIKey: GEBDBXYYQHUKAU-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 3-phenyl-2,1-benzoxazole-5-carboxylic acid |
| InChIKey | GEBDBXYYQHUKAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=C(C=CC3=NO2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Phenyl-benzo[c]isoxazole-5-carboxylic acid, 3-phenyl-2,1-benzoxazole-5-carboxylic acid, 3-phenyl-2,1-benzisoxazole-5-carboxylic acid, 3-phenylbenzo[c]isoxazole-5-carboxylic acid, ChemDiv1_025198, 2,1-Benzisoxazole-5-carboxylic acid, 3-phenyl-, Oprea1_312388, Oprea1_797003, GEBDBXYYQHUKAU-UHFFFAOYSA-N, 3-phenylbenzo[c]isoxazole-5-carboxylicacid