CAS 20146-25-2 appears in our catalog under these names: 2-(2-Furyl)-4-quinolinecarboxylic acid, 95%, 2-Furan-2-ylquinoline-4-carboxylic acid, 97%, 2-(Furan-2-yl)quinoline-4-carboxylic acid 95%, 2-(furan-2-yl)quinoline-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 2.5g, 10g, 25g, 100mg.
2-(furan-2-yl)quinoline-4-carboxylic acid (CAS 20146-25-2) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 2-(furan-2-yl)quinoline-4-carboxylic acid. InChIKey: WWEKTFINADFAEC-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-(furan-2-yl)quinoline-4-carboxylic acid |
| InChIKey | WWEKTFINADFAEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=CO3)C(=O)O |
Computed by PubChem (NCBI)