5-(Thiophen-3-yl)-1H-pyrrole-2-carboxylic acid, 97%
cas: 72078-42-3 — see every product listed under this CAS number, including other names
5-(Thiophen-3-yl)-1H-pyrrole-2-carboxylic acid, 97% (CAS 72078-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A185229-100mg |
| cas | 72078-42-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 626.25 Pln | |
| Ambeed | 250mg | 1455.06 Pln | |
| Ambeed | 1g | 4998.38 Pln | |
| BLDpharm | 50mg | 564.27 Pln | |
| BLDpharm | 100mg | 669.79 Pln | |
| BLDpharm | 250mg | 1563.92 Pln | |
| BLDpharm | 1g | 4896.08 Pln | |
| Chemat | 50mg | 477.20 Pln | |
| Chemat | 100mg | 765.20 Pln | |
| Fluorochem | 100mg | 1419.31 Pln | |
| Fluorochem | 50mg | 872.63 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5-thiophen-3-yl-1H-pyrrole-2-carboxylic acid (CAS 72078-42-3) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 5-thiophen-3-yl-1H-pyrrole-2-carboxylic acid. InChIKey: ANHBXSDONFXAEI-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 5-thiophen-3-yl-1H-pyrrole-2-carboxylic acid |
| InChIKey | ANHBXSDONFXAEI-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C2=CC=C(N2)C(=O)O |
Computed by PubChem (NCBI)