cas: 165948-21-0 — see every product listed under this CAS number, including other names
5-(tert-Butoxycarbonyl)-4,5,6,7-tetrahydrothiazolo(5,4-c)pyridine-2-carboxylic acid, 97% (CAS 165948-21-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A660205-5g |
| cas | 165948-21-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 12933.76 Pln | |
| AmBeed | 50mg | 701.47 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid (CAS 165948-21-0) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid. InChIKey: LLPCRFYYYVEWMH-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid |
| InChIKey | LLPCRFYYYVEWMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)SC(=N2)C(=O)O |
Computed by PubChem (NCBI)