CAS 889941-08-6 is the registry number for 1-(1,1-Dioxidotetrahydrothiophen-3-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid (CAS 889941-08-6) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid. InChIKey: XJWKTFSPDLRWAP-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| InChIKey | XJWKTFSPDLRWAP-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2C3CCS(=O)(=O)C3)C(=O)O |
Computed by PubChem (NCBI)