Products 1542590-85-1
CAS 1542590-85-1 is the registry number for Benzyl 3-(N-methylsulfamoyl)azetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 3-(methylsulfamoyl)azetidine-1-carboxylate (CAS 1542590-85-1) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: benzyl 3-(methylsulfamoyl)azetidine-1-carboxylate. InChIKey: MXHHERWRQGFKNO-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | benzyl 3-(methylsulfamoyl)azetidine-1-carboxylate |
| InChIKey | MXHHERWRQGFKNO-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1CN(C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)